C13H17NS — CID 138709523
(1Z)-3-methyl-1-[(3-methylphenyl)methylsulfanyl]buta-1,3-dien-1-amine (PubChem CID 138709523) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is (1Z)-3-methyl-1-[(3-methylphenyl)methylsulfanyl]buta-1,3-dien-1-amine.
| Compound Name | (1Z)-3-methyl-1-[(3-methylphenyl)methylsulfanyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 138709523 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (1Z)-3-methyl-1-[(3-methylphenyl)methylsulfanyl]buta-1,3-dien-1-amine |
| SMILES | C=C(C)/C=C(/N)SCc1cccc(C)c1 |
| InChI | InChI=1S/C13H17NS/c1-10(2)7-13(14)15-9-12-6-4-5-11(3)8-12/h4-8H,1,9,14H2,2-3H3/b13-7- |
| InChIKey | BBFPATNOSGHFHW-QPEQYQDCSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|