C16H25N3O3S — CID 138709590
(E,4S)-N-(4-amino-3-methylphenyl)sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide (PubChem CID 138709590) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is (E,4S)-N-(4-amino-3-methylphenyl)sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide.
| Compound Name | (E,4S)-N-(4-amino-3-methylphenyl)sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide |
|---|---|
| PubChem CID | 138709590 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E,4S)-N-(4-amino-3-methylphenyl)sulfonyl-2,5-dimethyl-4-(methylamino)hex-2-enamide |
| SMILES | CN[C@H](/C=C(\C)C(=O)NS(=O)(=O)c1ccc(N)c(C)c1)C(C)C |
| InChI | InChI=1S/C16H25N3O3S/c1-10(2)15(18-5)9-12(4)16(20)19-23(21,22)13-6-7-14(17)11(3)8-13/h6-10,15,18H,17H2,1-5H3,(H,19,20)/b12-9+/t15-/m1/s1 |
| InChIKey | DZNXONWUPPMWCN-SAAWKEMMSA-N |
| XLogP | 1.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|