C10H15NO — CID 138711950
5-ethyl-4-methoxycyclohepta-1,4,6-trien-1-amine (PubChem CID 138711950) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-ethyl-4-methoxycyclohepta-1,4,6-trien-1-amine.
| Compound Name | 5-ethyl-4-methoxycyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 138711950 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5-ethyl-4-methoxycyclohepta-1,4,6-trien-1-amine |
| SMILES | CCC1=C(OC)CC=C(N)C=C1 |
| InChI | InChI=1S/C10H15NO/c1-3-8-4-5-9(11)6-7-10(8)12-2/h4-6H,3,7,11H2,1-2H3 |
| InChIKey | OJDYAXSFIVKKCX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |