C8H11NO — CID 142264180
4-methoxycyclohepta-1,3,6-trien-1-amine (PubChem CID 142264180) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 4-methoxycyclohepta-1,3,6-trien-1-amine.
| Compound Name | 4-methoxycyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 142264180 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 4-methoxycyclohepta-1,3,6-trien-1-amine |
| SMILES | COC1=CC=C(N)C=CC1 |
| InChI | InChI=1S/C8H11NO/c1-10-8-4-2-3-7(9)5-6-8/h2-3,5-6H,4,9H2,1H3 |
| InChIKey | CVCARXIBUVPHGZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |