C10H15NO — CID 89035626
4-butoxycyclohexa-1,4,5-trien-1-amine (PubChem CID 89035626) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-butoxycyclohexa-1,4,5-trien-1-amine.
| Compound Name | 4-butoxycyclohexa-1,4,5-trien-1-amine |
|---|---|
| PubChem CID | 89035626 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-butoxycyclohexa-1,4,5-trien-1-amine |
| SMILES | CCCCOC1=C=CC(N)=CC1 |
| InChI | InChI=1S/C10H15NO/c1-2-3-8-12-10-6-4-9(11)5-7-10/h4-5H,2-3,6,8,11H2,1H3 |
| InChIKey | HXTHNFMKMZURFZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|