C44H33IN2OS — CID 138712027
2-tert-butyl-6-[[2-(4,6-dinaphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-iodophenol (PubChem CID 138712027) has the molecular formula C44H33IN2OS and a molecular weight of 764.73 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-(4,6-dinaphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-iodophenol.
| Compound Name | 2-tert-butyl-6-[[2-(4,6-dinaphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-iodophenol |
|---|---|
| PubChem CID | 138712027 |
| Molecular Formula | C44H33IN2OS |
| Molecular Weight | 764.73 g/mol |
| Exact Mass | 764.14 |
| IUPAC Name | 2-tert-butyl-6-[[2-(4,6-dinaphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-iodophenol |
| SMILES | CC(C)(C)c1cc(I)cc(/C=N/c2ccccc2-c2nc3c(-c4cccc5ccccc45)cc(-c4cccc5ccccc45)cc3s2)c1O |
| InChI | InChI=1S/C44H33IN2OS/c1-44(2,3)38-25-31(45)22-30(42(38)48)26-46-39-21-9-8-18-36(39)43-47-41-37(35-20-11-15-28-13-5-7-17-33(28)35)23-29(24-40(41)49-43)34-19-10-14-27-12-4-6-16-32(27)34/h4-26,48H,1-3H3/b46-26+ |
| InChIKey | VUGJNIMDPWDQCF-WUWMGIGGSA-N |
| XLogP | 12.96 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.73 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|