C8H8N4 — CID 138712698
N-(pyrazolo[5,4-b]pyridin-1-ylmethyl)methanimine (PubChem CID 138712698) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is N-(pyrazolo[5,4-b]pyridin-1-ylmethyl)methanimine.
| Compound Name | N-(pyrazolo[5,4-b]pyridin-1-ylmethyl)methanimine |
|---|---|
| PubChem CID | 138712698 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | N-(pyrazolo[5,4-b]pyridin-1-ylmethyl)methanimine |
| SMILES | C=NCn1ncc2cccnc21 |
| InChI | InChI=1S/C8H8N4/c1-9-6-12-8-7(5-11-12)3-2-4-10-8/h2-5H,1,6H2 |
| InChIKey | JXSKXDUDTLMBQM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|