C23H24O6 — CID 138714708
[2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-4-tert-butylphenyl] acetate (PubChem CID 138714708) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-4-tert-butylphenyl] acetate.
| Compound Name | [2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-4-tert-butylphenyl] acetate |
|---|---|
| PubChem CID | 138714708 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [2-(2-acetyloxy-1,3-dioxo-5,6-dihydroinden-2-yl)-4-tert-butylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(C)(C)C)cc1C1(OC(C)=O)C(=O)C2=CCCC=C2C1=O |
| InChI | InChI=1S/C23H24O6/c1-13(24)28-19-11-10-15(22(3,4)5)12-18(19)23(29-14(2)25)20(26)16-8-6-7-9-17(16)21(23)27/h8-12H,6-7H2,1-5H3 |
| InChIKey | VIUHOXYNFYZCPE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|