C22H33FN2O4 — CID 138716681
2-methoxyethyl 2-[(2R,5S)-1-[(2R)-2-aminopropanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate (PubChem CID 138716681) has the molecular formula C22H33FN2O4 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-methoxyethyl 2-[(2R,5S)-1-[(2R)-2-aminopropanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate.
| Compound Name | 2-methoxyethyl 2-[(2R,5S)-1-[(2R)-2-aminopropanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate |
|---|---|
| PubChem CID | 138716681 |
| Molecular Formula | C22H33FN2O4 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-methoxyethyl 2-[(2R,5S)-1-[(2R)-2-aminopropanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate |
| SMILES | CCC(CC)(C(=O)OCCOC)[C@H]1CC[C@@H](c2cccc(F)c2)N1C(=O)[C@@H](C)N |
| InChI | InChI=1S/C22H33FN2O4/c1-5-22(6-2,21(27)29-13-12-28-4)19-11-10-18(25(19)20(26)15(3)24)16-8-7-9-17(23)14-16/h7-9,14-15,18-19H,5-6,10-13,24H2,1-4H3/t15-,18+,19-/m1/s1 |
| InChIKey | BRINKGLDSLLFJE-AYOQOUSVSA-N |
| XLogP | 3.20 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|