C35H37FN2O5 — CID 138716095
benzyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate (PubChem CID 138716095) has the molecular formula C35H37FN2O5 and a molecular weight of 584.69 g/mol. Its IUPAC name is benzyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate.
| Compound Name | benzyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate |
|---|---|
| PubChem CID | 138716095 |
| Molecular Formula | C35H37FN2O5 |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | benzyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-ethylbutanoate |
| SMILES | CC[C@H](C(=O)N1[C@H](c2cccc(F)c2)CC[C@@H]1C(CC)(CC)C(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H37FN2O5/c1-4-28(38-31(39)26-17-10-11-18-27(26)32(38)40)33(41)37-29(24-15-12-16-25(36)21-24)19-20-30(37)35(5-2,6-3)34(42)43-22-23-13-8-7-9-14-23/h7-18,21,28-30H,4-6,19-20,22H2,1-3H3/t28-,29+,30-/m1/s1 |
| InChIKey | BYYTWTUDKNIJHF-DYIKCSJPSA-N |
| XLogP | 6.48 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|