C28H31FN2O5 — CID 138716103
ethyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-methylpropanoate (PubChem CID 138716103) has the molecular formula C28H31FN2O5 and a molecular weight of 494.56 g/mol. Its IUPAC name is ethyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 138716103 |
| Molecular Formula | C28H31FN2O5 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | ethyl 2-[(2R,5S)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)butanoyl]-5-(3-fluorophenyl)pyrrolidin-2-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)[C@H]1CC[C@@H](c2cccc(F)c2)N1C(=O)[C@@H](CC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H31FN2O5/c1-5-21(31-24(32)19-12-7-8-13-20(19)25(31)33)26(34)30-22(17-10-9-11-18(29)16-17)14-15-23(30)28(3,4)27(35)36-6-2/h7-13,16,21-23H,5-6,14-15H2,1-4H3/t21-,22+,23-/m1/s1 |
| InChIKey | DJXCJYSHFNUKBN-XPWALMASSA-N |
| XLogP | 4.52 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|