C25H24ClN3O3 — CID 138487630
2-[(2S,5S)-5-(3-chlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]pyrrolidin-2-yl]-2-methylpropanenitrile (PubChem CID 138487630) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 2-[(2S,5S)-5-(3-chlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]pyrrolidin-2-yl]-2-methylpropanenitrile.
| Compound Name | 2-[(2S,5S)-5-(3-chlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]pyrrolidin-2-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 138487630 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-[(2S,5S)-5-(3-chlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]pyrrolidin-2-yl]-2-methylpropanenitrile |
| SMILES | CC(C(=O)N1[C@H](C(C)(C)C#N)CC[C@H]1c1cccc(Cl)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H24ClN3O3/c1-15(28-23(31)18-9-4-5-10-19(18)24(28)32)22(30)29-20(16-7-6-8-17(26)13-16)11-12-21(29)25(2,3)14-27/h4-10,13,15,20-21H,11-12H2,1-3H3/t15?,20-,21-/m0/s1 |
| InChIKey | COBHNPFIMPOXJI-LBTAZEDMSA-N |
| XLogP | 4.61 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|