C14H16ClNO2 — CID 138487442
(2S,5R)-2-(3-chlorophenyl)-5-prop-1-en-2-ylpyrrolidine-1-carboxylic acid (PubChem CID 138487442) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is (2S,5R)-2-(3-chlorophenyl)-5-prop-1-en-2-ylpyrrolidine-1-carboxylic acid.
| Compound Name | (2S,5R)-2-(3-chlorophenyl)-5-prop-1-en-2-ylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 138487442 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (2S,5R)-2-(3-chlorophenyl)-5-prop-1-en-2-ylpyrrolidine-1-carboxylic acid |
| SMILES | C=C(C)[C@H]1CC[C@@H](c2cccc(Cl)c2)N1C(=O)O |
| InChI | InChI=1S/C14H16ClNO2/c1-9(2)12-6-7-13(16(12)14(17)18)10-4-3-5-11(15)8-10/h3-5,8,12-13H,1,6-7H2,2H3,(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | DLWCOKDKHLFLEF-OLZOCXBDSA-N |
| XLogP | 4.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|