C24H24F2N2O4 — CID 138487502
2-[1-[(2S,5R)-2-(3,5-difluorophenyl)-5-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 138487502) has the molecular formula C24H24F2N2O4 and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-[1-[(2S,5R)-2-(3,5-difluorophenyl)-5-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[(2S,5R)-2-(3,5-difluorophenyl)-5-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138487502 |
| Molecular Formula | C24H24F2N2O4 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[1-[(2S,5R)-2-(3,5-difluorophenyl)-5-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1[C@H](c2cc(F)cc(F)c2)CC[C@@H]1C(C)(C)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H24F2N2O4/c1-13(27-22(30)17-6-4-5-7-18(17)23(27)31)21(29)28-19(8-9-20(28)24(2,3)32)14-10-15(25)12-16(26)11-14/h4-7,10-13,19-20,32H,8-9H2,1-3H3/t13?,19-,20+/m0/s1 |
| InChIKey | NBKDRMWOCOJCRK-YYUCZDELSA-N |
| XLogP | 3.45 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|