C14H14F2N4 — CID 138718894
5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,3-dimethyl-2H-pyrazin-2-amine (PubChem CID 138718894) has the molecular formula C14H14F2N4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,3-dimethyl-2H-pyrazin-2-amine.
| Compound Name | 5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,3-dimethyl-2H-pyrazin-2-amine |
|---|---|
| PubChem CID | 138718894 |
| Molecular Formula | C14H14F2N4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,3-dimethyl-2H-pyrazin-2-amine |
| SMILES | CC1=NC(C#Cc2c(F)ccc(N)c2F)=CN(C)C1N |
| InChI | InChI=1S/C14H14F2N4/c1-8-14(18)20(2)7-9(19-8)3-4-10-11(15)5-6-12(17)13(10)16/h5-7,14H,17-18H2,1-2H3 |
| InChIKey | OFJNRKWXPMSXLL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|