C12H10F2N4 — CID 138718892
5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,2-dihydropyrimidin-2-amine (PubChem CID 138718892) has the molecular formula C12H10F2N4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,2-dihydropyrimidin-2-amine.
| Compound Name | 5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,2-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 138718892 |
| Molecular Formula | C12H10F2N4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 5-[2-(3-amino-2,6-difluorophenyl)ethynyl]-1,2-dihydropyrimidin-2-amine |
| SMILES | Nc1ccc(F)c(C#CC2=CNC(N)N=C2)c1F |
| InChI | InChI=1S/C12H10F2N4/c13-9-3-4-10(15)11(14)8(9)2-1-7-5-17-12(16)18-6-7/h3-6,12,17H,15-16H2 |
| InChIKey | RCPJPVRUHPXYHV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|