C15H17F2N3 — CID 138718380
5-[2-(3-amino-2,6-difluorophenyl)ethenyl]-3-ethyl-1,2-dihydropyridin-2-amine (PubChem CID 138718380) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-[2-(3-amino-2,6-difluorophenyl)ethenyl]-3-ethyl-1,2-dihydropyridin-2-amine.
| Compound Name | 5-[2-(3-amino-2,6-difluorophenyl)ethenyl]-3-ethyl-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 138718380 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 5-[2-(3-amino-2,6-difluorophenyl)ethenyl]-3-ethyl-1,2-dihydropyridin-2-amine |
| SMILES | CCC1=CC(C=Cc2c(F)ccc(N)c2F)=CNC1N |
| InChI | InChI=1S/C15H17F2N3/c1-2-10-7-9(8-20-15(10)19)3-4-11-12(16)5-6-13(18)14(11)17/h3-8,15,20H,2,18-19H2,1H3 |
| InChIKey | BVNOVUYYFVDMPA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|