C17H32O4 — CID 138721295
8-hydroxy-3,3-dimethyl-2-(6-oxoheptoxy)octan-4-one (PubChem CID 138721295) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is 8-hydroxy-3,3-dimethyl-2-(6-oxoheptoxy)octan-4-one.
| Compound Name | 8-hydroxy-3,3-dimethyl-2-(6-oxoheptoxy)octan-4-one |
|---|---|
| PubChem CID | 138721295 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 8-hydroxy-3,3-dimethyl-2-(6-oxoheptoxy)octan-4-one |
| SMILES | CC(=O)CCCCCOC(C)C(C)(C)C(=O)CCCCO |
| InChI | InChI=1S/C17H32O4/c1-14(19)10-6-5-9-13-21-15(2)17(3,4)16(20)11-7-8-12-18/h15,18H,5-13H2,1-4H3 |
| InChIKey | AUVIHAFPRVGZOJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|