C16H18N6O — CID 138723232
N-[3-(1H-benzimidazol-2-ylmethylamino)propyl]pyrazine-2-carboxamide (PubChem CID 138723232) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-ylmethylamino)propyl]pyrazine-2-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-ylmethylamino)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 138723232 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-ylmethylamino)propyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCCNCc1nc2ccccc2[nH]1)c1cnccn1 |
| InChI | InChI=1S/C16H18N6O/c23-16(14-10-18-8-9-19-14)20-7-3-6-17-11-15-21-12-4-1-2-5-13(12)22-15/h1-2,4-5,8-10,17H,3,6-7,11H2,(H,20,23)(H,21,22) |
| InChIKey | RFTHUUYBNZXVPI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|