C26H28N6O2 — CID 91821615
N-[6-[[1-(1H-benzimidazol-2-yl)-2-phenylethyl]amino]-6-oxohexyl]pyrazine-2-carboxamide (PubChem CID 91821615) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[6-[[1-(1H-benzimidazol-2-yl)-2-phenylethyl]amino]-6-oxohexyl]pyrazine-2-carboxamide.
| Compound Name | N-[6-[[1-(1H-benzimidazol-2-yl)-2-phenylethyl]amino]-6-oxohexyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91821615 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | N-[6-[[1-(1H-benzimidazol-2-yl)-2-phenylethyl]amino]-6-oxohexyl]pyrazine-2-carboxamide |
| SMILES | O=C(CCCCCNC(=O)c1cnccn1)NC(Cc1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H28N6O2/c33-24(13-5-2-8-14-29-26(34)23-18-27-15-16-28-23)30-22(17-19-9-3-1-4-10-19)25-31-20-11-6-7-12-21(20)32-25/h1,3-4,6-7,9-12,15-16,18,22H,2,5,8,13-14,17H2,(H,29,34)(H,30,33)(H,31,32) |
| InChIKey | UJWGRDPNNZJTGL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|