C16H21NOS — CID 138725744
1-[5-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-2-yl]ethanol (PubChem CID 138725744) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-[5-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[5-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 138725744 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[5-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-2-yl]ethanol |
| SMILES | Cc1nc(C(C)O)sc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H21NOS/c1-10-14(19-15(17-10)11(2)18)12-6-8-13(9-7-12)16(3,4)5/h6-9,11,18H,1-5H3 |
| InChIKey | WLOJAZBSLWFUOM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |