C22H31NO10 — CID 138733267
2-[(2S,3R,4S,5S)-2,3,5-triacetyloxy-6-(oct-7-ynylcarbamoyl)oxan-4-yl]acetic acid (PubChem CID 138733267) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5S)-2,3,5-triacetyloxy-6-(oct-7-ynylcarbamoyl)oxan-4-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4S,5S)-2,3,5-triacetyloxy-6-(oct-7-ynylcarbamoyl)oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 138733267 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[(2S,3R,4S,5S)-2,3,5-triacetyloxy-6-(oct-7-ynylcarbamoyl)oxan-4-yl]acetic acid |
| SMILES | C#CCCCCCCNC(=O)C1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](CC(=O)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H31NO10/c1-5-6-7-8-9-10-11-23-21(29)20-18(30-13(2)24)16(12-17(27)28)19(31-14(3)25)22(33-20)32-15(4)26/h1,16,18-20,22H,6-12H2,2-4H3,(H,23,29)(H,27,28)/t16-,18-,19+,20?,22+/m0/s1 |
| InChIKey | VKUDIGIZPZHXHM-BCAQEHJJSA-N |
| XLogP | 0.93 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|