C17H21NO10 — CID 135027817
[(2S,5S)-2,3,5-triacetyloxy-6-(prop-2-ynylcarbamoyl)oxan-4-yl] acetate (PubChem CID 135027817) has the molecular formula C17H21NO10 and a molecular weight of 399.35 g/mol. Its IUPAC name is [(2S,5S)-2,3,5-triacetyloxy-6-(prop-2-ynylcarbamoyl)oxan-4-yl] acetate.
| Compound Name | [(2S,5S)-2,3,5-triacetyloxy-6-(prop-2-ynylcarbamoyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 135027817 |
| Molecular Formula | C17H21NO10 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [(2S,5S)-2,3,5-triacetyloxy-6-(prop-2-ynylcarbamoyl)oxan-4-yl] acetate |
| SMILES | C#CCNC(=O)C1O[C@@H](OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H21NO10/c1-6-7-18-16(23)14-12(24-8(2)19)13(25-9(3)20)15(26-10(4)21)17(28-14)27-11(5)22/h1,12-15,17H,7H2,2-5H3,(H,18,23)/t12-,13?,14?,15?,17+/m0/s1 |
| InChIKey | AYDSFJNDKKEFKV-MZLGRULDSA-N |
| XLogP | -1.18 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|