C19H24BrN3O2 — CID 138733398
propan-2-yl 1-bromo-6-methyl-5-(1-piperazin-1-ylethenyl)indolizine-7-carboxylate (PubChem CID 138733398) has the molecular formula C19H24BrN3O2 and a molecular weight of 406.32 g/mol. Its IUPAC name is propan-2-yl 1-bromo-6-methyl-5-(1-piperazin-1-ylethenyl)indolizine-7-carboxylate.
| Compound Name | propan-2-yl 1-bromo-6-methyl-5-(1-piperazin-1-ylethenyl)indolizine-7-carboxylate |
|---|---|
| PubChem CID | 138733398 |
| Molecular Formula | C19H24BrN3O2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | propan-2-yl 1-bromo-6-methyl-5-(1-piperazin-1-ylethenyl)indolizine-7-carboxylate |
| SMILES | C=C(c1c(C)c(C(=O)OC(C)C)cc2c(Br)ccn12)N1CCNCC1 |
| InChI | InChI=1S/C19H24BrN3O2/c1-12(2)25-19(24)15-11-17-16(20)5-8-23(17)18(13(15)3)14(4)22-9-6-21-7-10-22/h5,8,11-12,21H,4,6-7,9-10H2,1-3H3 |
| InChIKey | BZDSWPYGAPWLAP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |