C17H14ClF3N2O7 — CID 138734324
(4-chlorophenyl) 2-[(2S,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-hydroxyacetate (PubChem CID 138734324) has the molecular formula C17H14ClF3N2O7 and a molecular weight of 450.75 g/mol. Its IUPAC name is (4-chlorophenyl) 2-[(2S,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-hydroxyacetate.
| Compound Name | (4-chlorophenyl) 2-[(2S,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 138734324 |
| Molecular Formula | C17H14ClF3N2O7 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | (4-chlorophenyl) 2-[(2S,3S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-hydroxyacetate |
| SMILES | O=C(Oc1ccc(Cl)cc1)C(O)[C@H]1O[C@@H](n2cc(C(F)(F)F)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C17H14ClF3N2O7/c18-7-1-3-8(4-2-7)29-15(27)12(25)13-10(24)5-11(30-13)23-6-9(17(19,20)21)14(26)22-16(23)28/h1-4,6,10-13,24-25H,5H2,(H,22,26,28)/t10-,11+,12?,13-/m0/s1 |
| InChIKey | YRCSOLZATNBEKZ-HNGCFSAESA-N |
| XLogP | 0.82 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|