C21H28ClN5O2 — CID 138735042
[3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-(6-chloro-2-methoxy-3-pyridinyl)-5-methylpyrazin-2-yl]methanol (PubChem CID 138735042) has the molecular formula C21H28ClN5O2 and a molecular weight of 417.94 g/mol. Its IUPAC name is [3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-(6-chloro-2-methoxy-3-pyridinyl)-5-methylpyrazin-2-yl]methanol.
| Compound Name | [3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-(6-chloro-2-methoxy-3-pyridinyl)-5-methylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 138735042 |
| Molecular Formula | C21H28ClN5O2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-(6-chloro-2-methoxy-3-pyridinyl)-5-methylpyrazin-2-yl]methanol |
| SMILES | COc1nc(Cl)ccc1-c1nc(CO)c(N2CCC3(CCCC3N)CC2)nc1C |
| InChI | InChI=1S/C21H28ClN5O2/c1-13-18(14-5-6-17(22)26-20(14)29-2)25-15(12-28)19(24-13)27-10-8-21(9-11-27)7-3-4-16(21)23/h5-6,16,28H,3-4,7-12,23H2,1-2H3 |
| InChIKey | ZMMYQUTZFXIJDB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|