C21H26Cl2N4O — CID 159997828
[6-(2,3-dichloro-4-pyridinyl)-5-methyl-3-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol (PubChem CID 159997828) has the molecular formula C21H26Cl2N4O and a molecular weight of 421.37 g/mol. Its IUPAC name is [6-(2,3-dichloro-4-pyridinyl)-5-methyl-3-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol.
| Compound Name | [6-(2,3-dichloro-4-pyridinyl)-5-methyl-3-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 159997828 |
| Molecular Formula | C21H26Cl2N4O |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [6-(2,3-dichloro-4-pyridinyl)-5-methyl-3-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol |
| SMILES | Cc1nc(N2CCC3(CCC[C@H]3C)CC2)c(CO)nc1-c1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C21H26Cl2N4O/c1-13-4-3-6-21(13)7-10-27(11-8-21)20-16(12-28)26-18(14(2)25-20)15-5-9-24-19(23)17(15)22/h5,9,13,28H,3-4,6-8,10-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | OHTRVOZZUBDKJQ-CYBMUJFWSA-N |
| XLogP | 5.05 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|