C17H21BrClN5O — CID 139309246
[3-(4-amino-4-methylpiperidin-1-yl)-6-(2-bromo-3-chloro-4-pyridinyl)-5-methylpyrazin-2-yl]methanol (PubChem CID 139309246) has the molecular formula C17H21BrClN5O and a molecular weight of 426.75 g/mol. Its IUPAC name is [3-(4-amino-4-methylpiperidin-1-yl)-6-(2-bromo-3-chloro-4-pyridinyl)-5-methylpyrazin-2-yl]methanol.
| Compound Name | [3-(4-amino-4-methylpiperidin-1-yl)-6-(2-bromo-3-chloro-4-pyridinyl)-5-methylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 139309246 |
| Molecular Formula | C17H21BrClN5O |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | [3-(4-amino-4-methylpiperidin-1-yl)-6-(2-bromo-3-chloro-4-pyridinyl)-5-methylpyrazin-2-yl]methanol |
| SMILES | Cc1nc(N2CCC(C)(N)CC2)c(CO)nc1-c1ccnc(Br)c1Cl |
| InChI | InChI=1S/C17H21BrClN5O/c1-10-14(11-3-6-21-15(18)13(11)19)23-12(9-25)16(22-10)24-7-4-17(2,20)5-8-24/h3,6,25H,4-5,7-9,20H2,1-2H3 |
| InChIKey | CGTJVEPXNJEAAI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|