C18H22BrClN4O — CID 149232735
[6-(3-bromo-2-chloro-4-pyridinyl)-3-(4,4-dimethylpiperidin-1-yl)-5-methylpyrazin-2-yl]methanol (PubChem CID 149232735) has the molecular formula C18H22BrClN4O and a molecular weight of 425.76 g/mol. Its IUPAC name is [6-(3-bromo-2-chloro-4-pyridinyl)-3-(4,4-dimethylpiperidin-1-yl)-5-methylpyrazin-2-yl]methanol.
| Compound Name | [6-(3-bromo-2-chloro-4-pyridinyl)-3-(4,4-dimethylpiperidin-1-yl)-5-methylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 149232735 |
| Molecular Formula | C18H22BrClN4O |
| Molecular Weight | 425.76 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | [6-(3-bromo-2-chloro-4-pyridinyl)-3-(4,4-dimethylpiperidin-1-yl)-5-methylpyrazin-2-yl]methanol |
| SMILES | Cc1nc(N2CCC(C)(C)CC2)c(CO)nc1-c1ccnc(Cl)c1Br |
| InChI | InChI=1S/C18H22BrClN4O/c1-11-15(12-4-7-21-16(20)14(12)19)23-13(10-25)17(22-11)24-8-5-18(2,3)6-9-24/h4,7,25H,5-6,8-10H2,1-3H3 |
| InChIKey | XKPRDSOUJCZGRY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|