C21H27Cl2N5O — CID 139309485
[3-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]-6-(4-amino-2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol (PubChem CID 139309485) has the molecular formula C21H27Cl2N5O and a molecular weight of 436.39 g/mol. Its IUPAC name is [3-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]-6-(4-amino-2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol.
| Compound Name | [3-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]-6-(4-amino-2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 139309485 |
| Molecular Formula | C21H27Cl2N5O |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [3-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]-6-(4-amino-2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol |
| SMILES | Cc1nc(N2CCC3(CCC[C@H]3N)CC2)c(CO)nc1-c1ccc(N)c(Cl)c1Cl |
| InChI | InChI=1S/C21H27Cl2N5O/c1-12-19(13-4-5-14(24)18(23)17(13)22)27-15(11-29)20(26-12)28-9-7-21(8-10-28)6-2-3-16(21)25/h4-5,16,29H,2-3,6-11,24-25H2,1H3/t16-/m1/s1 |
| InChIKey | CCHNBKYUEBFGLS-MRXNPFEDSA-N |
| XLogP | 3.93 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|