C31H62N2O4 — CID 138737622
1-[2-[2-[(7-amino-2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)amino]ethoxy]ethoxy]-3-ethyl-3,4-dimethyl-4-propyloctan-2-one (PubChem CID 138737622) has the molecular formula C31H62N2O4 and a molecular weight of 526.85 g/mol. Its IUPAC name is 1-[2-[2-[(7-amino-2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)amino]ethoxy]ethoxy]-3-ethyl-3,4-dimethyl-4-propyloctan-2-one.
| Compound Name | 1-[2-[2-[(7-amino-2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)amino]ethoxy]ethoxy]-3-ethyl-3,4-dimethyl-4-propyloctan-2-one |
|---|---|
| PubChem CID | 138737622 |
| Molecular Formula | C31H62N2O4 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.47 |
| IUPAC Name | 1-[2-[2-[(7-amino-2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)amino]ethoxy]ethoxy]-3-ethyl-3,4-dimethyl-4-propyloctan-2-one |
| SMILES | CCCCC(C)(CCC)C(C)(CC)C(=O)COCCOCCNC(C)(C)C(=O)C(C)(C)CC(C)(C)CN |
| InChI | InChI=1S/C31H62N2O4/c1-12-15-17-30(10,16-13-2)31(11,14-3)25(34)22-37-21-20-36-19-18-33-29(8,9)26(35)28(6,7)23-27(4,5)24-32/h33H,12-24,32H2,1-11H3 |
| InChIKey | IZZLYJFFVJWGCI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|