C19H42N2O5 — CID 171841426
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;2,2,4,4-tetramethylhexanoic acid (PubChem CID 171841426) has the molecular formula C19H42N2O5 and a molecular weight of 378.55 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;2,2,4,4-tetramethylhexanoic acid.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;2,2,4,4-tetramethylhexanoic acid |
|---|---|
| PubChem CID | 171841426 |
| Molecular Formula | C19H42N2O5 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;2,2,4,4-tetramethylhexanoic acid |
| SMILES | CC.CCC(C)(C)CC(C)(C)C(=O)O.NCCOCCOCCNC=O |
| InChI | InChI=1S/C10H20O2.C7H16N2O3.C2H6/c1-6-9(2,3)7-10(4,5)8(11)12;8-1-3-11-5-6-12-4-2-9-7-10;1-2/h6-7H2,1-5H3,(H,11,12);7H,1-6,8H2,(H,9,10);1-2H3 |
| InChIKey | ZPDLAZVSMVMGFQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|