C20H41NO3 — CID 91440027
3-ethyl-3-methyl-1-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethoxy]hexan-2-one (PubChem CID 91440027) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is 3-ethyl-3-methyl-1-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethoxy]hexan-2-one.
| Compound Name | 3-ethyl-3-methyl-1-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethoxy]hexan-2-one |
|---|---|
| PubChem CID | 91440027 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | 3-ethyl-3-methyl-1-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethoxy]hexan-2-one |
| SMILES | CCCC(C)(CC)NCCOCCOCC(=O)C(C)(CC)CCC |
| InChI | InChI=1S/C20H41NO3/c1-7-11-19(5,9-3)18(22)17-24-16-15-23-14-13-21-20(6,10-4)12-8-2/h21H,7-17H2,1-6H3 |
| InChIKey | OFGUPFUXMWMCNW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|