C22H24N2O2S — CID 138738128
2-[3-(methylamino)-1-phenylpropoxy]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 138738128) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-[3-(methylamino)-1-phenylpropoxy]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 2-[3-(methylamino)-1-phenylpropoxy]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 138738128 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[3-(methylamino)-1-phenylpropoxy]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CNCCC(Oc1ccccc1C(=O)NCc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-23-14-13-20(17-8-3-2-4-9-17)26-21-12-6-5-11-19(21)22(25)24-16-18-10-7-15-27-18/h2-12,15,20,23H,13-14,16H2,1H3,(H,24,25) |
| InChIKey | KRZQLAONRSUEKC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |