C19H29N3OS — CID 138738442
N-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 138738442) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is N-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 138738442 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CCNCC[C@@H](Oc1ccccc1NCCN(C)C)c1cccs1 |
| InChI | InChI=1S/C19H29N3OS/c1-4-20-12-11-18(19-10-7-15-24-19)23-17-9-6-5-8-16(17)21-13-14-22(2)3/h5-10,15,18,20-21H,4,11-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | OSNRBPRFNJDEFE-GOSISDBHSA-N |
| XLogP | 3.84 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|