C29H39N3OS — CID 138723905
1-[[2-[3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-N,N-dimethyl-4-phenylpiperidin-4-amine (PubChem CID 138723905) has the molecular formula C29H39N3OS and a molecular weight of 477.72 g/mol. Its IUPAC name is 1-[[2-[3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-N,N-dimethyl-4-phenylpiperidin-4-amine.
| Compound Name | 1-[[2-[3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-N,N-dimethyl-4-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 138723905 |
| Molecular Formula | C29H39N3OS |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | 1-[[2-[3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-N,N-dimethyl-4-phenylpiperidin-4-amine |
| SMILES | CCNCCC(Oc1ccccc1CN1CCC(c2ccccc2)(N(C)C)CC1)c1cccs1 |
| InChI | InChI=1S/C29H39N3OS/c1-4-30-19-16-27(28-15-10-22-34-28)33-26-14-9-8-11-24(26)23-32-20-17-29(18-21-32,31(2)3)25-12-6-5-7-13-25/h5-15,22,27,30H,4,16-21,23H2,1-3H3 |
| InChIKey | ZLETWGVOUCTBKE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|