C28H37N3O2S — CID 138724047
1-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-4-(4-methoxyphenyl)-N-methylpiperidin-4-amine (PubChem CID 138724047) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is 1-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-4-(4-methoxyphenyl)-N-methylpiperidin-4-amine.
| Compound Name | 1-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-4-(4-methoxyphenyl)-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 138724047 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-[2-[(1R)-3-(ethylamino)-1-thiophen-2-ylpropoxy]phenyl]-4-(4-methoxyphenyl)-N-methylpiperidin-4-amine |
| SMILES | CCNCC[C@@H](Oc1ccccc1N1CCC(NC)(c2ccc(OC)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C28H37N3O2S/c1-4-30-18-15-26(27-10-7-21-34-27)33-25-9-6-5-8-24(25)31-19-16-28(29-2,17-20-31)22-11-13-23(32-3)14-12-22/h5-14,21,26,29-30H,4,15-20H2,1-3H3/t26-/m1/s1 |
| InChIKey | HZDFVDWFPFBUTE-AREMUKBSSA-N |
| XLogP | 5.59 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|