C24H29N3OS — CID 139527786
1-[2-(3-amino-1-thiophen-2-ylpropoxy)phenyl]-4-phenylpiperidin-4-amine (PubChem CID 139527786) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-[2-(3-amino-1-thiophen-2-ylpropoxy)phenyl]-4-phenylpiperidin-4-amine.
| Compound Name | 1-[2-(3-amino-1-thiophen-2-ylpropoxy)phenyl]-4-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 139527786 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-[2-(3-amino-1-thiophen-2-ylpropoxy)phenyl]-4-phenylpiperidin-4-amine |
| SMILES | NCCC(Oc1ccccc1N1CCC(N)(c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C24H29N3OS/c25-15-12-22(23-11-6-18-29-23)28-21-10-5-4-9-20(21)27-16-13-24(26,14-17-27)19-7-2-1-3-8-19/h1-11,18,22H,12-17,25-26H2 |
| InChIKey | HPZVKDMRPQGRIF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |