C10H25N3 — CID 138739407
2-N'-(aminomethyl)-2-N'-(2,3-dimethylbutan-2-yl)propane-2,2-diamine (PubChem CID 138739407) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-N'-(aminomethyl)-2-N'-(2,3-dimethylbutan-2-yl)propane-2,2-diamine.
| Compound Name | 2-N'-(aminomethyl)-2-N'-(2,3-dimethylbutan-2-yl)propane-2,2-diamine |
|---|---|
| PubChem CID | 138739407 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 2-N'-(aminomethyl)-2-N'-(2,3-dimethylbutan-2-yl)propane-2,2-diamine |
| SMILES | CC(C)C(C)(C)N(CN)C(C)(C)N |
| InChI | InChI=1S/C10H25N3/c1-8(2)9(3,4)13(7-11)10(5,6)12/h8H,7,11-12H2,1-6H3 |
| InChIKey | NVMLFSUBRKAHMM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|