About N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine
N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine (PubChem CID 87751828) has the molecular formula C11H28N2
and a molecular weight of 188.36 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine.
Analyze N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine?
The IUPAC name of N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine (CID 87751828) is N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine.
What is the SMILES notation for N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine?
The canonical SMILES for N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine is CC(C)C(C)(N)C(C)C.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine?
The InChIKey is UUHNFYLLXYVWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H9N/c1-6(2)8(5,9)7(3)4;1-4(2)3/h6-7H,9H2,1-5H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine?
N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine has a molecular weight of 188.36 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;2,3,4-trimethylpentan-3-amine is sourced from PubChem (CID 87751828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).