C9H23NO3S — CID 173156179
methanesulfonic acid;2,3,4-trimethylpentan-3-amine (PubChem CID 173156179) has the molecular formula C9H23NO3S and a molecular weight of 225.35 g/mol. Its IUPAC name is methanesulfonic acid;2,3,4-trimethylpentan-3-amine.
| Compound Name | methanesulfonic acid;2,3,4-trimethylpentan-3-amine |
|---|---|
| PubChem CID | 173156179 |
| Molecular Formula | C9H23NO3S |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methanesulfonic acid;2,3,4-trimethylpentan-3-amine |
| SMILES | CC(C)C(C)(N)C(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C8H19N.CH4O3S/c1-6(2)8(5,9)7(3)4;1-5(2,3)4/h6-7H,9H2,1-5H3;1H3,(H,2,3,4) |
| InChIKey | BCLBYNDKQVWKSH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|