C15H29N3O2 — CID 138739557
3-(3-methyl-2,5-dihydro-1,2,4-triazin-6-yl)-1-[(2-methylpropan-2-yl)oxy]heptan-1-ol (PubChem CID 138739557) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 3-(3-methyl-2,5-dihydro-1,2,4-triazin-6-yl)-1-[(2-methylpropan-2-yl)oxy]heptan-1-ol.
| Compound Name | 3-(3-methyl-2,5-dihydro-1,2,4-triazin-6-yl)-1-[(2-methylpropan-2-yl)oxy]heptan-1-ol |
|---|---|
| PubChem CID | 138739557 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 3-(3-methyl-2,5-dihydro-1,2,4-triazin-6-yl)-1-[(2-methylpropan-2-yl)oxy]heptan-1-ol |
| SMILES | CCCCC(CC(O)OC(C)(C)C)C1=NNC(C)=NC1 |
| InChI | InChI=1S/C15H29N3O2/c1-6-7-8-12(9-14(19)20-15(3,4)5)13-10-16-11(2)17-18-13/h12,14,19H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | DWHVHTSZONVHHL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|