C15H27NO — CID 138739942
(4E,6Z)-N-(cyclopropylmethyl)-N-ethyl-4-methoxyocta-4,6-dien-1-amine (PubChem CID 138739942) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (4E,6Z)-N-(cyclopropylmethyl)-N-ethyl-4-methoxyocta-4,6-dien-1-amine.
| Compound Name | (4E,6Z)-N-(cyclopropylmethyl)-N-ethyl-4-methoxyocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 138739942 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (4E,6Z)-N-(cyclopropylmethyl)-N-ethyl-4-methoxyocta-4,6-dien-1-amine |
| SMILES | C/C=C\C=C(/CCCN(CC)CC1CC1)OC |
| InChI | InChI=1S/C15H27NO/c1-4-6-8-15(17-3)9-7-12-16(5-2)13-14-10-11-14/h4,6,8,14H,5,7,9-13H2,1-3H3/b6-4-,15-8+ |
| InChIKey | CNKVXRMFTOHAHK-KKMCOEOTSA-N |
| XLogP | 3.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|