C14H30O4 — CID 138741119
4-octan-3-yloxyhexane-1,2,6-triol (PubChem CID 138741119) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is 4-octan-3-yloxyhexane-1,2,6-triol.
| Compound Name | 4-octan-3-yloxyhexane-1,2,6-triol |
|---|---|
| PubChem CID | 138741119 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 4-octan-3-yloxyhexane-1,2,6-triol |
| SMILES | CCCCCC(CC)OC(CCO)CC(O)CO |
| InChI | InChI=1S/C14H30O4/c1-3-5-6-7-13(4-2)18-14(8-9-15)10-12(17)11-16/h12-17H,3-11H2,1-2H3 |
| InChIKey | DCCDAXHEKIDHGQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|