About 2-carbamoyloxyethenyl N-propan-2-ylcarbamate
2-carbamoyloxyethenyl N-propan-2-ylcarbamate (PubChem CID 138742163) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-carbamoyloxyethenyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | 2-carbamoyloxyethenyl N-propan-2-ylcarbamate |
| PubChem CID | 138742163 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-carbamoyloxyethenyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC=COC(N)=O |
| InChI | InChI=1S/C7H12N2O4/c1-5(2)9-7(11)13-4-3-12-6(8)10/h3-5H,1-2H3,(H2,8,10)(H,9,11) |
| InChIKey | HNIYOISUWUUFAE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamoyloxyethenyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoyloxyethenyl N-propan-2-ylcarbamate?
The IUPAC name of 2-carbamoyloxyethenyl N-propan-2-ylcarbamate (CID 138742163) is 2-carbamoyloxyethenyl N-propan-2-ylcarbamate.
What is the SMILES notation for 2-carbamoyloxyethenyl N-propan-2-ylcarbamate?
The canonical SMILES for 2-carbamoyloxyethenyl N-propan-2-ylcarbamate is CC(C)NC(=O)OC=COC(N)=O.
What is the InChIKey of 2-carbamoyloxyethenyl N-propan-2-ylcarbamate?
The InChIKey is HNIYOISUWUUFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4/c1-5(2)9-7(11)13-4-3-12-6(8)10/h3-5H,1-2H3,(H2,8,10)(H,9,11).
What are the key properties of 2-carbamoyloxyethenyl N-propan-2-ylcarbamate?
2-carbamoyloxyethenyl N-propan-2-ylcarbamate has a molecular weight of 188.18 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyloxyethenyl N-propan-2-ylcarbamate is sourced from PubChem (CID 138742163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).