C24H27NO — CID 138742854
7-[5-(1-benzofuran-6-yl)-2,5-dimethylhexan-2-yl]-1H-indole (PubChem CID 138742854) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 7-[5-(1-benzofuran-6-yl)-2,5-dimethylhexan-2-yl]-1H-indole.
| Compound Name | 7-[5-(1-benzofuran-6-yl)-2,5-dimethylhexan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 138742854 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 7-[5-(1-benzofuran-6-yl)-2,5-dimethylhexan-2-yl]-1H-indole |
| SMILES | CC(C)(CCC(C)(C)c1cccc2cc[nH]c12)c1ccc2ccoc2c1 |
| InChI | InChI=1S/C24H27NO/c1-23(2,19-9-8-17-11-15-26-21(17)16-19)12-13-24(3,4)20-7-5-6-18-10-14-25-22(18)20/h5-11,14-16,25H,12-13H2,1-4H3 |
| InChIKey | YHGTXSCJHRIHCY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |