C24H29NO — CID 167565439
4-tert-butyl-1-benzofuran;7-tert-butyl-1H-indole (PubChem CID 167565439) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is 4-tert-butyl-1-benzofuran;7-tert-butyl-1H-indole.
| Compound Name | 4-tert-butyl-1-benzofuran;7-tert-butyl-1H-indole |
|---|---|
| PubChem CID | 167565439 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 4-tert-butyl-1-benzofuran;7-tert-butyl-1H-indole |
| SMILES | CC(C)(C)c1cccc2cc[nH]c12.CC(C)(C)c1cccc2occc12 |
| InChI | InChI=1S/C12H15N.C12H14O/c1-12(2,3)10-6-4-5-9-7-8-13-11(9)10;1-12(2,3)10-5-4-6-11-9(10)7-8-13-11/h4-8,13H,1-3H3;4-8H,1-3H3 |
| InChIKey | FFHGBPGOIKABJD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |