About 4-bromo-1-benzofuran;ethane
4-bromo-1-benzofuran;ethane (PubChem CID 166455445) has the molecular formula C10H11BrO
and a molecular weight of 227.10 g/mol. Its IUPAC name is 4-bromo-1-benzofuran;ethane.
Molecular Properties
| Compound Name | 4-bromo-1-benzofuran;ethane |
| PubChem CID | 166455445 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 4-bromo-1-benzofuran;ethane |
| SMILES | Brc1cccc2occc12.CC |
| InChI | InChI=1S/C8H5BrO.C2H6/c9-7-2-1-3-8-6(7)4-5-10-8;1-2/h1-5H;1-2H3 |
| InChIKey | ZDLAIKOQTWNUHL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-1-benzofuran;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-benzofuran;ethane?
The IUPAC name of 4-bromo-1-benzofuran;ethane (CID 166455445) is 4-bromo-1-benzofuran;ethane.
What is the SMILES notation for 4-bromo-1-benzofuran;ethane?
The canonical SMILES for 4-bromo-1-benzofuran;ethane is Brc1cccc2occc12.CC.
What is the InChIKey of 4-bromo-1-benzofuran;ethane?
The InChIKey is ZDLAIKOQTWNUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrO.C2H6/c9-7-2-1-3-8-6(7)4-5-10-8;1-2/h1-5H;1-2H3.
What are the key properties of 4-bromo-1-benzofuran;ethane?
4-bromo-1-benzofuran;ethane has a molecular weight of 227.10 g/mol, XLogP of 4.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-benzofuran;ethane is sourced from PubChem (CID 166455445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).