C24H18F8N4O3 — CID 138743264
4-[4-[[2-[2-fluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-oxoethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 138743264) has the molecular formula C24H18F8N4O3 and a molecular weight of 562.42 g/mol. Its IUPAC name is 4-[4-[[2-[2-fluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-oxoethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[2-[2-fluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-oxoethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 138743264 |
| Molecular Formula | C24H18F8N4O3 |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 4-[4-[[2-[2-fluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-oxoethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NCC(=O)Nc3cc(C(F)(C(F)(F)F)C(F)(F)F)ccc3F)cc2)ccn1 |
| InChI | InChI=1S/C24H18F8N4O3/c1-33-21(38)19-11-16(8-9-34-19)39-15-5-3-14(4-6-15)35-12-20(37)36-18-10-13(2-7-17(18)25)22(26,23(27,28)29)24(30,31)32/h2-11,35H,12H2,1H3,(H,33,38)(H,36,37) |
| InChIKey | APBXCUBYDGSTAA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |