C24H19FN4O4 — CID 138743714
4-[4-[[2-(2-fluoro-5-methylanilino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 138743714) has the molecular formula C24H19FN4O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is 4-[4-[[2-(2-fluoro-5-methylanilino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[2-(2-fluoro-5-methylanilino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 138743714 |
| Molecular Formula | C24H19FN4O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[4-[[2-(2-fluoro-5-methylanilino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(Nc3c(Nc4cc(C)ccc4F)c(=O)c3=O)cc2)ccn1 |
| InChI | InChI=1S/C24H19FN4O4/c1-13-3-8-17(25)18(11-13)29-21-20(22(30)23(21)31)28-14-4-6-15(7-5-14)33-16-9-10-27-19(12-16)24(32)26-2/h3-12,28-29H,1-2H3,(H,26,32) |
| InChIKey | PUGMDSUEPFLGIS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|